C18H17FN6O — CID 75475624
1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-pyridin-4-ylurea (PubChem CID 75475624) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-pyridin-4-ylurea.
| Compound Name | 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 75475624 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-pyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)NC1CCc2nnc(-c3ccc(F)cc3)n2C1 |
| InChI | InChI=1S/C18H17FN6O/c19-13-3-1-12(2-4-13)17-24-23-16-6-5-15(11-25(16)17)22-18(26)21-14-7-9-20-10-8-14/h1-4,7-10,15H,5-6,11H2,(H2,20,21,22,26) |
| InChIKey | NNSBWGUDCPFCOO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |