C14H15F2N5O — CID 97343562
1-(3,4-difluorophenyl)-3-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]urea (PubChem CID 97343562) has the molecular formula C14H15F2N5O and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 97343562 |
| Molecular Formula | C14H15F2N5O |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]urea |
| SMILES | Cc1nnc2n1C[C@@H](NC(=O)Nc1ccc(F)c(F)c1)CC2 |
| InChI | InChI=1S/C14H15F2N5O/c1-8-19-20-13-5-3-10(7-21(8)13)18-14(22)17-9-2-4-11(15)12(16)6-9/h2,4,6,10H,3,5,7H2,1H3,(H2,17,18,22)/t10-/m0/s1 |
| InChIKey | MBECIZUFGIKLNI-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |