C19H21F2N3O — CID 112990296
1-cyclohexyl-3-[4-(3,4-difluoroanilino)phenyl]urea (PubChem CID 112990296) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(3,4-difluoroanilino)phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(3,4-difluoroanilino)phenyl]urea |
|---|---|
| PubChem CID | 112990296 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-cyclohexyl-3-[4-(3,4-difluoroanilino)phenyl]urea |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(F)c2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-17-11-10-16(12-18(17)21)22-14-6-8-15(9-7-14)24-19(25)23-13-4-2-1-3-5-13/h6-13,22H,1-5H2,(H2,23,24,25) |
| InChIKey | MFHRWTZXSKYONL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |