C15H14F2N4O — CID 113023257
1-cyclopropyl-3-[6-(3,4-difluoroanilino)-3-pyridinyl]urea (PubChem CID 113023257) has the molecular formula C15H14F2N4O and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-[6-(3,4-difluoroanilino)-3-pyridinyl]urea.
| Compound Name | 1-cyclopropyl-3-[6-(3,4-difluoroanilino)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 113023257 |
| Molecular Formula | C15H14F2N4O |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-cyclopropyl-3-[6-(3,4-difluoroanilino)-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(F)c2)nc1)NC1CC1 |
| InChI | InChI=1S/C15H14F2N4O/c16-12-5-3-10(7-13(12)17)19-14-6-4-11(8-18-14)21-15(22)20-9-1-2-9/h3-9H,1-2H2,(H,18,19)(H2,20,21,22) |
| InChIKey | WVMHGRWFWHDIGG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |