C16H15F2N3O — CID 113037624
N-[5-(3,4-difluoroanilino)-2-pyridinyl]cyclobutanecarboxamide (PubChem CID 113037624) has the molecular formula C16H15F2N3O and a molecular weight of 303.31 g/mol. Its IUPAC name is N-[5-(3,4-difluoroanilino)-2-pyridinyl]cyclobutanecarboxamide.
| Compound Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113037624 |
| Molecular Formula | C16H15F2N3O |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(F)c2)cn1)C1CCC1 |
| InChI | InChI=1S/C16H15F2N3O/c17-13-6-4-11(8-14(13)18)20-12-5-7-15(19-9-12)21-16(22)10-2-1-3-10/h4-10,20H,1-3H2,(H,19,21,22) |
| InChIKey | XYEMZKQJRLJIJC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |