C17H19N3O2 — CID 113034101
N-[5-(3-methoxyanilino)-2-pyridinyl]cyclobutanecarboxamide (PubChem CID 113034101) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[5-(3-methoxyanilino)-2-pyridinyl]cyclobutanecarboxamide.
| Compound Name | N-[5-(3-methoxyanilino)-2-pyridinyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113034101 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[5-(3-methoxyanilino)-2-pyridinyl]cyclobutanecarboxamide |
| SMILES | COc1cccc(Nc2ccc(NC(=O)C3CCC3)nc2)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-22-15-7-3-6-13(10-15)19-14-8-9-16(18-11-14)20-17(21)12-4-2-5-12/h3,6-12,19H,2,4-5H2,1H3,(H,18,20,21) |
| InChIKey | JSNNKHHKLCRBPI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |