C10H11FN2O — CID 840492
1-cyclopropyl-3-(4-fluorophenyl)urea (PubChem CID 840492) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-fluorophenyl)urea.
| Compound Name | 1-cyclopropyl-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 840492 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-cyclopropyl-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CC1 |
| InChI | InChI=1S/C10H11FN2O/c11-7-1-3-8(4-2-7)12-10(14)13-9-5-6-9/h1-4,9H,5-6H2,(H2,12,13,14) |
| InChIKey | MCZDWHZJEKCGOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |