C13H15F4N3O — CID 82794523
1-(4-fluorophenyl)-3-[6-(trifluoromethyl)piperidin-3-yl]urea (PubChem CID 82794523) has the molecular formula C13H15F4N3O and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[6-(trifluoromethyl)piperidin-3-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[6-(trifluoromethyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 82794523 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[6-(trifluoromethyl)piperidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)NC1CCC(C(F)(F)F)NC1 |
| InChI | InChI=1S/C13H15F4N3O/c14-8-1-3-9(4-2-8)19-12(21)20-10-5-6-11(18-7-10)13(15,16)17/h1-4,10-11,18H,5-7H2,(H2,19,20,21) |
| InChIKey | QNUIUCILWYMBTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |