C8H14F3N3O — CID 82810862
1-methyl-3-[6-(trifluoromethyl)piperidin-3-yl]urea (PubChem CID 82810862) has the molecular formula C8H14F3N3O and a molecular weight of 225.21 g/mol. Its IUPAC name is 1-methyl-3-[6-(trifluoromethyl)piperidin-3-yl]urea.
| Compound Name | 1-methyl-3-[6-(trifluoromethyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 82810862 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-methyl-3-[6-(trifluoromethyl)piperidin-3-yl]urea |
| SMILES | CNC(=O)NC1CCC(C(F)(F)F)NC1 |
| InChI | InChI=1S/C8H14F3N3O/c1-12-7(15)14-5-2-3-6(13-4-5)8(9,10)11/h5-6,13H,2-4H2,1H3,(H2,12,14,15) |
| InChIKey | KGHJZOQMYWLSDS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |