C9H16F3N3O3 — CID 174864512
1-methyl-3-piperidin-4-ylurea;2,2,2-trifluoroacetic acid (PubChem CID 174864512) has the molecular formula C9H16F3N3O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-methyl-3-piperidin-4-ylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-3-piperidin-4-ylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174864512 |
| Molecular Formula | C9H16F3N3O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-methyl-3-piperidin-4-ylurea;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)NC1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H15N3O.C2HF3O2/c1-8-7(11)10-6-2-4-9-5-3-6;3-2(4,5)1(6)7/h6,9H,2-5H2,1H3,(H2,8,10,11);(H,6,7) |
| InChIKey | CWQUNETTXHYUGF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |