C8H15FN2O — CID 130670834
1-(4-fluorocyclohexyl)-3-methylurea (PubChem CID 130670834) has the molecular formula C8H15FN2O and a molecular weight of 174.22 g/mol. Its IUPAC name is 1-(4-fluorocyclohexyl)-3-methylurea.
| Compound Name | 1-(4-fluorocyclohexyl)-3-methylurea |
|---|---|
| PubChem CID | 130670834 |
| Molecular Formula | C8H15FN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(4-fluorocyclohexyl)-3-methylurea |
| SMILES | CNC(=O)NC1CCC(F)CC1 |
| InChI | InChI=1S/C8H15FN2O/c1-10-8(12)11-7-4-2-6(9)3-5-7/h6-7H,2-5H2,1H3,(H2,10,11,12) |
| InChIKey | IOARPFLMLWLTMJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |