C17H30N4O5 — CID 144980876
methyl N-[4-[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]cyclohexyl]carbamate (PubChem CID 144980876) has the molecular formula C17H30N4O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl N-[4-[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]cyclohexyl]carbamate.
| Compound Name | methyl N-[4-[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 144980876 |
| Molecular Formula | C17H30N4O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | methyl N-[4-[[4-(methoxycarbonylamino)cyclohexyl]carbamoylamino]cyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(NC(=O)NC2CCC(NC(=O)OC)CC2)CC1 |
| InChI | InChI=1S/C17H30N4O5/c1-25-16(23)20-13-7-3-11(4-8-13)18-15(22)19-12-5-9-14(10-6-12)21-17(24)26-2/h11-14H,3-10H2,1-2H3,(H,20,23)(H,21,24)(H2,18,19,22) |
| InChIKey | VYCRPDBOELLJKQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |