C13H25NO2 — CID 168760317
methyl N-[4-(2,2-dimethylpropyl)cyclohexyl]carbamate (PubChem CID 168760317) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is methyl N-[4-(2,2-dimethylpropyl)cyclohexyl]carbamate.
| Compound Name | methyl N-[4-(2,2-dimethylpropyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168760317 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | methyl N-[4-(2,2-dimethylpropyl)cyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25NO2/c1-13(2,3)9-10-5-7-11(8-6-10)14-12(15)16-4/h10-11H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | MOFAZESCEKLSHH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |