C17H32N2O3 — CID 86277406
tert-butyl N-[4-(3,3-dimethylbutanoylamino)cyclohexyl]carbamate (PubChem CID 86277406) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is tert-butyl N-[4-(3,3-dimethylbutanoylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(3,3-dimethylbutanoylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 86277406 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | tert-butyl N-[4-(3,3-dimethylbutanoylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)CC(=O)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32N2O3/c1-16(2,3)11-14(20)18-12-7-9-13(10-8-12)19-15(21)22-17(4,5)6/h12-13H,7-11H2,1-6H3,(H,18,20)(H,19,21) |
| InChIKey | DAEMECXKQMKXCS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |