C11H24Cl2N2O2 — CID 140801985
tert-butyl N-(4-aminocyclohexyl)carbamate;dihydrochloride (PubChem CID 140801985) has the molecular formula C11H24Cl2N2O2 and a molecular weight of 287.23 g/mol. Its IUPAC name is tert-butyl N-(4-aminocyclohexyl)carbamate;dihydrochloride.
| Compound Name | tert-butyl N-(4-aminocyclohexyl)carbamate;dihydrochloride |
|---|---|
| PubChem CID | 140801985 |
| Molecular Formula | C11H24Cl2N2O2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | tert-butyl N-(4-aminocyclohexyl)carbamate;dihydrochloride |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N)CC1.Cl.Cl |
| InChI | InChI=1S/C11H22N2O2.2ClH/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9;;/h8-9H,4-7,12H2,1-3H3,(H,13,14);2*1H |
| InChIKey | XXHJDCKCQKHBMK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |