C17H32N2O4 — CID 174975403
tert-butyl N-[4-(4-amino-1-hydroxycyclohexyl)-4-hydroxycyclohexyl]carbamate (PubChem CID 174975403) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl N-[4-(4-amino-1-hydroxycyclohexyl)-4-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-amino-1-hydroxycyclohexyl)-4-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 174975403 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl N-[4-(4-amino-1-hydroxycyclohexyl)-4-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)(C2(O)CCC(N)CC2)CC1 |
| InChI | InChI=1S/C17H32N2O4/c1-15(2,3)23-14(20)19-13-6-10-17(22,11-7-13)16(21)8-4-12(18)5-9-16/h12-13,21-22H,4-11,18H2,1-3H3,(H,19,20) |
| InChIKey | LBIASLLZAJGTOZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |