C12H22INO3 — CID 134289716
tert-butyl N-[4-hydroxy-4-(iodomethyl)cyclohexyl]carbamate (PubChem CID 134289716) has the molecular formula C12H22INO3 and a molecular weight of 355.22 g/mol. Its IUPAC name is tert-butyl N-[4-hydroxy-4-(iodomethyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-hydroxy-4-(iodomethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 134289716 |
| Molecular Formula | C12H22INO3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | tert-butyl N-[4-hydroxy-4-(iodomethyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)(CI)CC1 |
| InChI | InChI=1S/C12H22INO3/c1-11(2,3)17-10(15)14-9-4-6-12(16,8-13)7-5-9/h9,16H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | YVVMTYWZNLODLG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|