C14H23FN2O4 — CID 153459245
tert-butyl N-[4-fluoro-4-(2-oxoethylcarbamoyl)cyclohexyl]carbamate (PubChem CID 153459245) has the molecular formula C14H23FN2O4 and a molecular weight of 302.35 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-4-(2-oxoethylcarbamoyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-4-(2-oxoethylcarbamoyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 153459245 |
| Molecular Formula | C14H23FN2O4 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | tert-butyl N-[4-fluoro-4-(2-oxoethylcarbamoyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(F)(C(=O)NCC=O)CC1 |
| InChI | InChI=1S/C14H23FN2O4/c1-13(2,3)21-12(20)17-10-4-6-14(15,7-5-10)11(19)16-8-9-18/h9-10H,4-8H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | HYQFWCVONNHMDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|