C11H22N2O4 — CID 22990009
tert-butyl N-piperidin-4-ylcarbamate;formic acid (PubChem CID 22990009) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is tert-butyl N-piperidin-4-ylcarbamate;formic acid.
| Compound Name | tert-butyl N-piperidin-4-ylcarbamate;formic acid |
|---|---|
| PubChem CID | 22990009 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | tert-butyl N-piperidin-4-ylcarbamate;formic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCNCC1.O=CO |
| InChI | InChI=1S/C10H20N2O2.CH2O2/c1-10(2,3)14-9(13)12-8-4-6-11-7-5-8;2-1-3/h8,11H,4-7H2,1-3H3,(H,12,13);1H,(H,2,3) |
| InChIKey | VCMFXPMRLKFGKA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|