C10H20N2O3 — CID 118178604
tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate (PubChem CID 118178604) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118178604 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNCC[C@@H]1O |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-7-6-11-5-4-8(7)13/h7-8,11,13H,4-6H2,1-3H3,(H,12,14)/t7-,8+/m1/s1 |
| InChIKey | REUNVCLBHFFYFH-SFYZADRCSA-N |
| XLogP | 0.23 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |