C10H22ClN3O2 — CID 155892811
tert-butyl N-(4-aminopiperidin-3-yl)carbamate;hydrochloride (PubChem CID 155892811) has the molecular formula C10H22ClN3O2 and a molecular weight of 251.76 g/mol. Its IUPAC name is tert-butyl N-(4-aminopiperidin-3-yl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(4-aminopiperidin-3-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 155892811 |
| Molecular Formula | C10H22ClN3O2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | tert-butyl N-(4-aminopiperidin-3-yl)carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NC1CNCCC1N.Cl |
| InChI | InChI=1S/C10H21N3O2.ClH/c1-10(2,3)15-9(14)13-8-6-12-5-4-7(8)11;/h7-8,12H,4-6,11H2,1-3H3,(H,13,14);1H |
| InChIKey | VGWJTWPAQDPUJZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |