C11H23N3O5 — CID 69182337
tert-butyl N-[(3R,4S)-3-hydroxypiperidin-4-yl]carbamate;carbamic acid (PubChem CID 69182337) has the molecular formula C11H23N3O5 and a molecular weight of 277.32 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-3-hydroxypiperidin-4-yl]carbamate;carbamic acid.
| Compound Name | tert-butyl N-[(3R,4S)-3-hydroxypiperidin-4-yl]carbamate;carbamic acid |
|---|---|
| PubChem CID | 69182337 |
| Molecular Formula | C11H23N3O5 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | tert-butyl N-[(3R,4S)-3-hydroxypiperidin-4-yl]carbamate;carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCNC[C@H]1O.NC(=O)O |
| InChI | InChI=1S/C10H20N2O3.CH3NO2/c1-10(2,3)15-9(14)12-7-4-5-11-6-8(7)13;2-1(3)4/h7-8,11,13H,4-6H2,1-3H3,(H,12,14);2H2,(H,3,4)/t7-,8+;/m0./s1 |
| InChIKey | PHLQNKJBPZEDAL-KZYPOYLOSA-N |
| XLogP | -0.14 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |