C12H22N2O7 — CID 138108864
tert-butyl N-(4-hydroxypiperidin-3-yl)carbamate;oxalic acid (PubChem CID 138108864) has the molecular formula C12H22N2O7 and a molecular weight of 306.32 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxypiperidin-3-yl)carbamate;oxalic acid.
| Compound Name | tert-butyl N-(4-hydroxypiperidin-3-yl)carbamate;oxalic acid |
|---|---|
| PubChem CID | 138108864 |
| Molecular Formula | C12H22N2O7 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl N-(4-hydroxypiperidin-3-yl)carbamate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)NC1CNCCC1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H20N2O3.C2H2O4/c1-10(2,3)15-9(14)12-7-6-11-5-4-8(7)13;3-1(4)2(5)6/h7-8,11,13H,4-6H2,1-3H3,(H,12,14);(H,3,4)(H,5,6) |
| InChIKey | PYSJHAYLPOIBKE-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|