C16H34N2O3Si — CID 174031687
tert-butyl N-[(3R)-4-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate (PubChem CID 174031687) has the molecular formula C16H34N2O3Si and a molecular weight of 330.55 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-4-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174031687 |
| Molecular Formula | C16H34N2O3Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl N-[(3R)-4-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCCC1CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C16H34N2O3Si/c1-15(2,3)21-14(19)18-13-11-17-9-8-12(13)10-16(4,5)22(6,7)20/h12-13,17,20H,8-11H2,1-7H3,(H,18,19)/t12?,13-/m0/s1 |
| InChIKey | HMRAMBUVDHONDX-ABLWVSNPSA-N |
| XLogP | 2.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|