C15H26N4O2 — CID 174858928
tert-butyl N-piperidin-4-ylcarbamate;pyridin-2-amine (PubChem CID 174858928) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl N-piperidin-4-ylcarbamate;pyridin-2-amine.
| Compound Name | tert-butyl N-piperidin-4-ylcarbamate;pyridin-2-amine |
|---|---|
| PubChem CID | 174858928 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | tert-butyl N-piperidin-4-ylcarbamate;pyridin-2-amine |
| SMILES | CC(C)(C)OC(=O)NC1CCNCC1.Nc1ccccn1 |
| InChI | InChI=1S/C10H20N2O2.C5H6N2/c1-10(2,3)14-9(13)12-8-4-6-11-7-5-8;6-5-3-1-2-4-7-5/h8,11H,4-7H2,1-3H3,(H,12,13);1-4H,(H2,6,7) |
| InChIKey | NYHFSAWDMXFXGT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |