C15H24N4O2 — CID 99620412
tert-butyl N-[(1S,3R)-3-(pyrimidin-2-ylamino)cyclohexyl]carbamate (PubChem CID 99620412) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-(pyrimidin-2-ylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-(pyrimidin-2-ylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 99620412 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-(pyrimidin-2-ylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H](Nc2ncccn2)C1 |
| InChI | InChI=1S/C15H24N4O2/c1-15(2,3)21-14(20)19-12-7-4-6-11(10-12)18-13-16-8-5-9-17-13/h5,8-9,11-12H,4,6-7,10H2,1-3H3,(H,19,20)(H,16,17,18)/t11-,12+/m1/s1 |
| InChIKey | NAZNOOVVJYAOFG-NEPJUHHUSA-N |
| XLogP | 2.72 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |