C14H21IN4O2 — CID 171767267
tert-butyl N-[(1S,3S)-3-[(5-iodopyrimidin-2-yl)amino]cyclopentyl]carbamate (PubChem CID 171767267) has the molecular formula C14H21IN4O2 and a molecular weight of 404.25 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-3-[(5-iodopyrimidin-2-yl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-3-[(5-iodopyrimidin-2-yl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 171767267 |
| Molecular Formula | C14H21IN4O2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | tert-butyl N-[(1S,3S)-3-[(5-iodopyrimidin-2-yl)amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](Nc2ncc(I)cn2)C1 |
| InChI | InChI=1S/C14H21IN4O2/c1-14(2,3)21-13(20)19-11-5-4-10(6-11)18-12-16-7-9(15)8-17-12/h7-8,10-11H,4-6H2,1-3H3,(H,19,20)(H,16,17,18)/t10-,11-/m0/s1 |
| InChIKey | YIMDLWSGRNWVRM-QWRGUYRKSA-N |
| XLogP | 2.94 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|