C15H24N4O3 — CID 169248595
tert-butyl N-[3-[(1-methylpyrazole-3-carbonyl)amino]cyclopentyl]carbamate (PubChem CID 169248595) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-methylpyrazole-3-carbonyl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-methylpyrazole-3-carbonyl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 169248595 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl N-[3-[(1-methylpyrazole-3-carbonyl)amino]cyclopentyl]carbamate |
| SMILES | Cn1ccc(C(=O)NC2CCC(NC(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C15H24N4O3/c1-15(2,3)22-14(21)17-11-6-5-10(9-11)16-13(20)12-7-8-19(4)18-12/h7-8,10-11H,5-6,9H2,1-4H3,(H,16,20)(H,17,21) |
| InChIKey | NQOKLDHSACIOJO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |