C17H26N4O2 — CID 146882600
tert-butyl N-[4-[(5-ethenylpyrimidin-2-yl)amino]cyclohexyl]carbamate (PubChem CID 146882600) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-ethenylpyrimidin-2-yl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-ethenylpyrimidin-2-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 146882600 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | tert-butyl N-[4-[(5-ethenylpyrimidin-2-yl)amino]cyclohexyl]carbamate |
| SMILES | C=Cc1cnc(NC2CCC(NC(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C17H26N4O2/c1-5-12-10-18-15(19-11-12)20-13-6-8-14(9-7-13)21-16(22)23-17(2,3)4/h5,10-11,13-14H,1,6-9H2,2-4H3,(H,21,22)(H,18,19,20) |
| InChIKey | STUBTRIJADTOQJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |