C24H40BN5O5 — CID 99867130
tert-butyl N-[(2R)-1-oxo-1-[[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]propan-2-yl]carbamate (PubChem CID 99867130) has the molecular formula C24H40BN5O5 and a molecular weight of 489.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-[[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-[[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867130 |
| Molecular Formula | C24H40BN5O5 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-[[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]propan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)NC1CCC(Nc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C24H40BN5O5/c1-15(28-21(32)33-22(2,3)4)19(31)29-17-9-11-18(12-10-17)30-20-26-13-16(14-27-20)25-34-23(5,6)24(7,8)35-25/h13-15,17-18H,9-12H2,1-8H3,(H,28,32)(H,29,31)(H,26,27,30)/t15-,17?,18?/m1/s1 |
| InChIKey | KYKSLRILXUSVMC-FAEJEUNOSA-N |
| XLogP | 2.53 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|