C23H37BN4O7S — CID 99867166
tert-butyl N-[(2R)-1-oxo-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-2-yl]carbamate (PubChem CID 99867166) has the molecular formula C23H37BN4O7S and a molecular weight of 524.45 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867166 |
| Molecular Formula | C23H37BN4O7S |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCC(S(=O)(=O)c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C23H37BN4O7S/c1-15(27-20(30)33-21(2,3)4)18(29)28-11-9-17(10-12-28)36(31,32)19-25-13-16(14-26-19)24-34-22(5,6)23(7,8)35-24/h13-15,17H,9-12H2,1-8H3,(H,27,30)/t15-/m1/s1 |
| InChIKey | PSKFOTAPNFDOBX-OAHLLOKOSA-N |
| XLogP | 1.45 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|