C25H41BN4O7S — CID 99867178
tert-butyl N-[(2R)-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 99867178) has the molecular formula C25H41BN4O7S and a molecular weight of 552.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867178 |
| Molecular Formula | C25H41BN4O7S |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCC(CCS(=O)(=O)c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C25H41BN4O7S/c1-17(29-22(32)35-23(2,3)4)20(31)30-12-9-18(10-13-30)11-14-38(33,34)21-27-15-19(16-28-21)26-36-24(5,6)25(7,8)37-26/h15-18H,9-14H2,1-8H3,(H,29,32)/t17-/m1/s1 |
| InChIKey | TXULIULIOAJMFT-QGZVFWFLSA-N |
| XLogP | 2.09 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|