C19H29BClN3O5S — CID 71633980
2-chloro-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]ethanone (PubChem CID 71633980) has the molecular formula C19H29BClN3O5S and a molecular weight of 457.79 g/mol. Its IUPAC name is 2-chloro-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71633980 |
| Molecular Formula | C19H29BClN3O5S |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-chloro-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2cnc(S(=O)(=O)CCC3CCN(C(=O)CCl)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H29BClN3O5S/c1-18(2)19(3,4)29-20(28-18)15-12-22-17(23-13-15)30(26,27)10-7-14-5-8-24(9-6-14)16(25)11-21/h12-14H,5-11H2,1-4H3 |
| InChIKey | LRIUEECVEKLXOL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|