C17H25BClN3O5S — CID 71633924
2-chloro-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanone (PubChem CID 71633924) has the molecular formula C17H25BClN3O5S and a molecular weight of 429.74 g/mol. Its IUPAC name is 2-chloro-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71633924 |
| Molecular Formula | C17H25BClN3O5S |
| Molecular Weight | 429.74 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-chloro-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2cnc(S(=O)(=O)[C@@H]3CCCN(C(=O)CCl)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H25BClN3O5S/c1-16(2)17(3,4)27-18(26-16)12-9-20-15(21-10-12)28(24,25)13-6-5-7-22(11-13)14(23)8-19/h9-10,13H,5-8,11H2,1-4H3/t13-/m1/s1 |
| InChIKey | HCPDDXBXPJVUSY-CYBMUJFWSA-N |
| XLogP | 0.78 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.74 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|