C20H30BClN4O3 — CID 71633806
2-chloro-1-[(3S)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 71633806) has the molecular formula C20H30BClN4O3 and a molecular weight of 420.75 g/mol. Its IUPAC name is 2-chloro-1-[(3S)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[(3S)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71633806 |
| Molecular Formula | C20H30BClN4O3 |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-chloro-1-[(3S)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2cnc(N(C3CC3)[C@H]3CCCN(C(=O)CCl)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C20H30BClN4O3/c1-19(2)20(3,4)29-21(28-19)14-11-23-18(24-12-14)26(15-7-8-15)16-6-5-9-25(13-16)17(27)10-22/h11-12,15-16H,5-10,13H2,1-4H3/t16-/m0/s1 |
| InChIKey | AJJKLPICIBLWAZ-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|