C19H30BClN4O3 — CID 71647503
2-chloro-1-[2-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanone (PubChem CID 71647503) has the molecular formula C19H30BClN4O3 and a molecular weight of 408.74 g/mol. Its IUPAC name is 2-chloro-1-[2-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[2-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71647503 |
| Molecular Formula | C19H30BClN4O3 |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-chloro-1-[2-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanone |
| SMILES | CN(CC1CCCCN1C(=O)CCl)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C19H30BClN4O3/c1-18(2)19(3,4)28-20(27-18)14-11-22-17(23-12-14)24(5)13-15-8-6-7-9-25(15)16(26)10-21/h11-12,15H,6-10,13H2,1-5H3 |
| InChIKey | BMHHFIIRSVOXCU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|