C27H46BN5O5 — CID 129460758
tert-butyl N-[(2S)-1-oxo-1-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 129460758) has the molecular formula C27H46BN5O5 and a molecular weight of 531.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 129460758 |
| Molecular Formula | C27H46BN5O5 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(C)N(C[C@@H]1CCCCN1C(=O)[C@H](C)NC(=O)OC(C)(C)C)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C27H46BN5O5/c1-18(2)33(23-29-15-20(16-30-23)28-37-26(7,8)27(9,10)38-28)17-21-13-11-12-14-32(21)22(34)19(3)31-24(35)36-25(4,5)6/h15-16,18-19,21H,11-14,17H2,1-10H3,(H,31,35)/t19-,21-/m0/s1 |
| InChIKey | UHZGQOXSPJMCSM-FPOVZHCZSA-N |
| XLogP | 3.28 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|