C26H43BN4O7S — CID 71632705
tert-butyl N-[3-methyl-1-oxo-1-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632705) has the molecular formula C26H43BN4O7S and a molecular weight of 566.53 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632705 |
| Molecular Formula | C26H43BN4O7S |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCCCC1CS(=O)(=O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C26H43BN4O7S/c1-17(2)20(30-23(33)36-24(3,4)5)21(32)31-13-11-10-12-19(31)16-39(34,35)22-28-14-18(15-29-22)27-37-25(6,7)26(8,9)38-27/h14-15,17,19-20H,10-13,16H2,1-9H3,(H,30,33) |
| InChIKey | AZVCLKVAIXREAU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|