C28H47BN4O7S — CID 99884708
tert-butyl N-[(2R)-3-methyl-1-oxo-1-[(2R)-2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpropyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 99884708) has the molecular formula C28H47BN4O7S and a molecular weight of 594.58 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-oxo-1-[(2R)-2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpropyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[(2R)-2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpropyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 99884708 |
| Molecular Formula | C28H47BN4O7S |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[(2R)-2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpropyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCCC[C@@H]1CCCS(=O)(=O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C28H47BN4O7S/c1-19(2)22(32-25(35)38-26(3,4)5)23(34)33-15-11-10-13-21(33)14-12-16-41(36,37)24-30-17-20(18-31-24)29-39-27(6,7)28(8,9)40-29/h17-19,21-22H,10-16H2,1-9H3,(H,32,35)/t21-,22-/m1/s1 |
| InChIKey | CHAAUSIQXISFHR-FGZHOGPDSA-N |
| XLogP | 3.26 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|