C26H43BN4O6 — CID 71633562
tert-butyl N-[1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 71633562) has the molecular formula C26H43BN4O6 and a molecular weight of 518.46 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71633562 |
| Molecular Formula | C26H43BN4O6 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)N1CCCCC1CCCOc1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C26H43BN4O6/c1-18(30-23(33)35-24(2,3)4)21(32)31-14-10-9-12-20(31)13-11-15-34-22-28-16-19(17-29-22)27-36-25(5,6)26(7,8)37-27/h16-18,20H,9-15H2,1-8H3,(H,30,33) |
| InChIKey | DMEQQOWQPNJULD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|