C28H47BN4O6 — CID 71632694
tert-butyl N-[3-methyl-1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632694) has the molecular formula C28H47BN4O6 and a molecular weight of 546.52 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632694 |
| Molecular Formula | C28H47BN4O6 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCCCC1CCCOc1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C28H47BN4O6/c1-19(2)22(32-25(35)37-26(3,4)5)23(34)33-15-11-10-13-21(33)14-12-16-36-24-30-17-20(18-31-24)29-38-27(6,7)28(8,9)39-29/h17-19,21-22H,10-16H2,1-9H3,(H,32,35) |
| InChIKey | NCPUXXJNVYALLO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|