C27H45BN4O6 — CID 99884559
tert-butyl N-[(2R)-3-methyl-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxyethyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 99884559) has the molecular formula C27H45BN4O6 and a molecular weight of 532.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxyethyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxyethyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 99884559 |
| Molecular Formula | C27H45BN4O6 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxyethyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCC(CCOc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C27H45BN4O6/c1-18(2)21(31-24(34)36-25(3,4)5)22(33)32-13-10-19(11-14-32)12-15-35-23-29-16-20(17-30-23)28-37-26(6,7)27(8,9)38-28/h16-19,21H,10-15H2,1-9H3,(H,31,34)/t21-/m1/s1 |
| InChIKey | SLCSXBILBMVFLJ-OAQYLSRUSA-N |
| XLogP | 3.33 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|