C28H48BN5O5 — CID 71632639
tert-butyl N-[3-methyl-1-oxo-1-[3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632639) has the molecular formula C28H48BN5O5 and a molecular weight of 545.53 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632639 |
| Molecular Formula | C28H48BN5O5 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCC(CN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C(C)C)C1 |
| InChI | InChI=1S/C28H48BN5O5/c1-18(2)22(32-25(36)37-26(5,6)7)23(35)33-13-12-20(16-33)17-34(19(3)4)24-30-14-21(15-31-24)29-38-27(8,9)28(10,11)39-29/h14-15,18-20,22H,12-13,16-17H2,1-11H3,(H,32,36) |
| InChIKey | GRRWBLWWRLTDKV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|