C21H35BN4O5 — CID 99934838
(2S)-2,3-dihydroxy-1-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 99934838) has the molecular formula C21H35BN4O5 and a molecular weight of 434.35 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-1-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99934838 |
| Molecular Formula | C21H35BN4O5 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(C)N(C[C@H]1CCN(C(=O)[C@@H](O)CO)C1)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C21H35BN4O5/c1-14(2)26(12-15-7-8-25(11-15)18(29)17(28)13-27)19-23-9-16(10-24-19)22-30-20(3,4)21(5,6)31-22/h9-10,14-15,17,27-28H,7-8,11-13H2,1-6H3/t15-,17-/m0/s1 |
| InChIKey | RDTSHUQSOUZTAU-RDJZCZTQSA-N |
| XLogP | 0.19 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|