C17H27BN4O5 — CID 99867381
(2S)-2,3-dihydroxy-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]propan-1-one (PubChem CID 99867381) has the molecular formula C17H27BN4O5 and a molecular weight of 378.24 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2S)-2,3-dihydroxy-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867381 |
| Molecular Formula | C17H27BN4O5 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2S)-2,3-dihydroxy-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(N[C@H]3CCN(C(=O)[C@@H](O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H27BN4O5/c1-16(2)17(3,4)27-18(26-16)11-7-19-15(20-8-11)21-12-5-6-22(9-12)14(25)13(24)10-23/h7-8,12-13,23-24H,5-6,9-10H2,1-4H3,(H,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | ZYESXZAFOHRPGO-STQMWFEESA-N |
| XLogP | -0.86 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|