C17H26BN3O6 — CID 71634039
2,3-dihydroxy-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypyrrolidin-1-yl]propan-1-one (PubChem CID 71634039) has the molecular formula C17H26BN3O6 and a molecular weight of 379.22 g/mol. Its IUPAC name is 2,3-dihydroxy-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypyrrolidin-1-yl]propan-1-one.
| Compound Name | 2,3-dihydroxy-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71634039 |
| Molecular Formula | C17H26BN3O6 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2,3-dihydroxy-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypyrrolidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(O[C@@H]3CCN(C(=O)C(O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H26BN3O6/c1-16(2)17(3,4)27-18(26-16)11-7-19-15(20-8-11)25-12-5-6-21(9-12)14(24)13(23)10-22/h7-8,12-13,22-23H,5-6,9-10H2,1-4H3/t12-,13?/m1/s1 |
| InChIKey | AZLRLMJZDGDRGH-PZORYLMUSA-N |
| XLogP | -0.89 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|