C18H28BN3O6 — CID 71634057
2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypiperidin-1-yl]propan-1-one (PubChem CID 71634057) has the molecular formula C18H28BN3O6 and a molecular weight of 393.25 g/mol. Its IUPAC name is 2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypiperidin-1-yl]propan-1-one.
| Compound Name | 2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71634057 |
| Molecular Formula | C18H28BN3O6 |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypiperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(OC3CCN(C(=O)C(O)CO)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C18H28BN3O6/c1-17(2)18(3,4)28-19(27-17)12-9-20-16(21-10-12)26-13-5-7-22(8-6-13)15(25)14(24)11-23/h9-10,13-14,23-24H,5-8,11H2,1-4H3 |
| InChIKey | CQBXUSVIRXZDOO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|