C21H34BN3O6 — CID 99867729
(2S)-2,3-dihydroxy-1-[(3R)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-1-one (PubChem CID 99867729) has the molecular formula C21H34BN3O6 and a molecular weight of 435.33 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-1-[(3R)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867729 |
| Molecular Formula | C21H34BN3O6 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxypropyl]piperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(OCCC[C@H]3CCCN(C(=O)[C@@H](O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C21H34BN3O6/c1-20(2)21(3,4)31-22(30-20)16-11-23-19(24-12-16)29-10-6-8-15-7-5-9-25(13-15)18(28)17(27)14-26/h11-12,15,17,26-27H,5-10,13-14H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | CFNITPVYFRYGIR-WBVHZDCISA-N |
| XLogP | 0.53 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|