C22H37BN4O5 — CID 129407107
(2R)-2,3-dihydroxy-1-[(3S)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-1-one (PubChem CID 129407107) has the molecular formula C22H37BN4O5 and a molecular weight of 448.37 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[(3S)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2,3-dihydroxy-1-[(3S)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 129407107 |
| Molecular Formula | C22H37BN4O5 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[(3S)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)N(C[C@@H]1CCCN(C(=O)[C@H](O)CO)C1)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C22H37BN4O5/c1-15(2)27(13-16-8-7-9-26(12-16)19(30)18(29)14-28)20-24-10-17(11-25-20)23-31-21(3,4)22(5,6)32-23/h10-11,15-16,18,28-29H,7-9,12-14H2,1-6H3/t16-,18-/m1/s1 |
| InChIKey | FFCZTGHLFGRVDJ-SJLPKXTDSA-N |
| XLogP | 0.58 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|