C21H35BN4O5 — CID 71632733
2,3-dihydroxy-1-[(3R)-3-[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one (PubChem CID 71632733) has the molecular formula C21H35BN4O5 and a molecular weight of 434.35 g/mol. Its IUPAC name is 2,3-dihydroxy-1-[(3R)-3-[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | 2,3-dihydroxy-1-[(3R)-3-[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71632733 |
| Molecular Formula | C21H35BN4O5 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2,3-dihydroxy-1-[(3R)-3-[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)N(c1ncc(B2OC(C)(C)C(C)(C)O2)cn1)[C@@H]1CCCN(C(=O)C(O)CO)C1 |
| InChI | InChI=1S/C21H35BN4O5/c1-14(2)26(16-8-7-9-25(12-16)18(29)17(28)13-27)19-23-10-15(11-24-19)22-30-20(3,4)21(5,6)31-22/h10-11,14,16-17,27-28H,7-9,12-13H2,1-6H3/t16-,17?/m1/s1 |
| InChIKey | GOIHKEROJXTYLV-TZHYSIJRSA-N |
| XLogP | 0.33 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|